C20H26O3 — CID 101169900
methyl 4-[(1S,2R,7S,9S,10S)-10-hydroxy-9-methyl-10-tricyclo[7.1.1.02,7]undecanyl]benzoate (PubChem CID 101169900) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 4-[(1S,2R,7S,9S,10S)-10-hydroxy-9-methyl-10-tricyclo[7.1.1.02,7]undecanyl]benzoate.
| Compound Name | methyl 4-[(1S,2R,7S,9S,10S)-10-hydroxy-9-methyl-10-tricyclo[7.1.1.02,7]undecanyl]benzoate |
|---|---|
| PubChem CID | 101169900 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl 4-[(1S,2R,7S,9S,10S)-10-hydroxy-9-methyl-10-tricyclo[7.1.1.02,7]undecanyl]benzoate |
| SMILES | COC(=O)c1ccc([C@]2(O)[C@H]3C[C@]2(C)C[C@@H]2CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C20H26O3/c1-19-11-14-5-3-4-6-16(14)17(12-19)20(19,22)15-9-7-13(8-10-15)18(21)23-2/h7-10,14,16-17,22H,3-6,11-12H2,1-2H3/t14-,16+,17-,19-,20-/m0/s1 |
| InChIKey | GETCXBQQZFVCHC-MFMLGXQFSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |