About (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate
(2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate (PubChem CID 10117000) has the molecular formula C30H32FN3O2
and a molecular weight of 485.60 g/mol. Its IUPAC name is (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate.
Molecular Properties
| Compound Name | (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate |
| PubChem CID | 10117000 |
| Molecular Formula | C30H32FN3O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate |
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCC(C)NC(=O)Oc1ccccc1F |
| InChI | InChI=1S/C30H32FN3O2/c1-22(32-30(35)36-27-20-12-11-19-26(27)31)14-6-5-13-21-34-23(2)33-28(24-15-7-3-8-16-24)29(34)25-17-9-4-10-18-25/h3-4,7-12,15-20,22H,5-6,13-14,21H2,1-2H3,(H,32,35) |
| InChIKey | LXGNTFODLNMYKQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate?
The IUPAC name of (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate (CID 10117000) is (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate.
What is the SMILES notation for (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate?
The canonical SMILES for (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate is Cc1nc(-c2ccccc2)c(-c2ccccc2)n1CCCCCC(C)NC(=O)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate?
The InChIKey is LXGNTFODLNMYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32FN3O2/c1-22(32-30(35)36-27-20-12-11-19-26(27)31)14-6-5-13-21-34-23(2)33-28(24-15-7-3-8-16-24)29(34)25-17-9-4-10-18-25/h3-4,7-12,15-20,22H,5-6,13-14,21H2,1-2H3,(H,32,35).
What are the key properties of (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate?
(2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate has a molecular weight of 485.60 g/mol, XLogP of 7.40, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) N-[7-(2-methyl-4,5-diphenylimidazol-1-yl)heptan-2-yl]carbamate is sourced from PubChem (CID 10117000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).