C13H16FNO2 — CID 101170044
(3R,5S)-1-benzyl-3-fluoro-5-(methoxymethyl)pyrrolidin-2-one (PubChem CID 101170044) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (3R,5S)-1-benzyl-3-fluoro-5-(methoxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,5S)-1-benzyl-3-fluoro-5-(methoxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 101170044 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3R,5S)-1-benzyl-3-fluoro-5-(methoxymethyl)pyrrolidin-2-one |
| SMILES | COC[C@@H]1C[C@@H](F)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H16FNO2/c1-17-9-11-7-12(14)13(16)15(11)8-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | SDXMPJLRLRXKGE-NWDGAFQWSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |