C22H28F3N3O6 — CID 10117086
ethyl 4-ethyl-5-(ethylcarbamoyl)-2-[(4-methoxyanilino)methyl]-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 10117086) has the molecular formula C22H28F3N3O6 and a molecular weight of 487.48 g/mol. Its IUPAC name is ethyl 4-ethyl-5-(ethylcarbamoyl)-2-[(4-methoxyanilino)methyl]-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 4-ethyl-5-(ethylcarbamoyl)-2-[(4-methoxyanilino)methyl]-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10117086 |
| Molecular Formula | C22H28F3N3O6 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | ethyl 4-ethyl-5-(ethylcarbamoyl)-2-[(4-methoxyanilino)methyl]-1H-pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCNC(=O)c1[nH]c(CNc2ccc(OC)cc2)c(C(=O)OCC)c1CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O4.C2HF3O2/c1-5-15-17(20(25)27-7-3)16(23-18(15)19(24)21-6-2)12-22-13-8-10-14(26-4)11-9-13;3-2(4,5)1(6)7/h8-11,22-23H,5-7,12H2,1-4H3,(H,21,24);(H,6,7) |
| InChIKey | AMGORBNNDCITTQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|