About (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol
(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol (PubChem CID 101171663) has the molecular formula C15H30O2Si
and a molecular weight of 270.49 g/mol. Its IUPAC name is (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol.
Molecular Properties
| Compound Name | (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol |
| PubChem CID | 101171663 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C\CCC/C=C/CO |
| InChI | InChI=1S/C15H30O2Si/c1-15(2,3)18(4,5)17-14-12-10-8-6-7-9-11-13-16/h9-12,16H,6-8,13-14H2,1-5H3/b11-9+,12-10- |
| InChIKey | BDDOELIYPBHGFV-IXIPZQGVSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol?
The IUPAC name of (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol (CID 101171663) is (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol.
What is the SMILES notation for (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol?
The canonical SMILES for (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol is CC(C)(C)[Si](C)(C)OC/C=C\CCC/C=C/CO.
What is the InChIKey of (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol?
The InChIKey is BDDOELIYPBHGFV-IXIPZQGVSA-N. The full InChI is InChI=1S/C15H30O2Si/c1-15(2,3)18(4,5)17-14-12-10-8-6-7-9-11-13-16/h9-12,16H,6-8,13-14H2,1-5H3/b11-9+,12-10-.
What are the key properties of (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol?
(2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol has a molecular weight of 270.49 g/mol, XLogP of 4.28, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,7Z)-9-[tert-butyl(dimethyl)silyl]oxynona-2,7-dien-1-ol is sourced from PubChem (CID 101171663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).