C28H44N2O5 — CID 10117183
[(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-(4-methylpiperazin-1-yl)-3-oxopropanoate (PubChem CID 10117183) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-(4-methylpiperazin-1-yl)-3-oxopropanoate.
| Compound Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-(4-methylpiperazin-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 10117183 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 3-(4-methylpiperazin-1-yl)-3-oxopropanoate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CC(=O)N2CCN(C)CC2)[C@]2(C)C(C)CC[C@]3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H44N2O5/c1-7-26(4)17-21(35-23(33)16-22(32)30-14-12-29(6)13-15-30)27(5)18(2)8-10-28(19(3)25(26)34)11-9-20(31)24(27)28/h7,18-19,21,24-25,34H,1,8-17H2,2-6H3/t18?,19-,21+,24?,25-,26+,27-,28-/m0/s1 |
| InChIKey | SXVZUXSAFWTZHQ-MVUQEMTISA-N |
| XLogP | 3.06 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|