C16H15NO3S — CID 101171861
ethyl 4-methyl-5-oxo-2-phenyl-6H-thieno[3,2-b]pyrrole-6-carboxylate (PubChem CID 101171861) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is ethyl 4-methyl-5-oxo-2-phenyl-6H-thieno[3,2-b]pyrrole-6-carboxylate.
| Compound Name | ethyl 4-methyl-5-oxo-2-phenyl-6H-thieno[3,2-b]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 101171861 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | ethyl 4-methyl-5-oxo-2-phenyl-6H-thieno[3,2-b]pyrrole-6-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(C)c2cc(-c3ccccc3)sc21 |
| InChI | InChI=1S/C16H15NO3S/c1-3-20-16(19)13-14-11(17(2)15(13)18)9-12(21-14)10-7-5-4-6-8-10/h4-9,13H,3H2,1-2H3 |
| InChIKey | TVHSYKHUOINYED-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|