C14H17F3N2O4 — CID 101172333
(2R,5R)-N,5-dihydroxy-1-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-2-carboxamide (PubChem CID 101172333) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is (2R,5R)-N,5-dihydroxy-1-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-2-carboxamide.
| Compound Name | (2R,5R)-N,5-dihydroxy-1-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 101172333 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2R,5R)-N,5-dihydroxy-1-[[3-(trifluoromethyl)phenyl]methoxy]piperidine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CC[C@@H](O)CN1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4/c15-14(16,17)10-3-1-2-9(6-10)8-23-19-7-11(20)4-5-12(19)13(21)18-22/h1-3,6,11-12,20,22H,4-5,7-8H2,(H,18,21)/t11-,12-/m1/s1 |
| InChIKey | COPRTDUXTWITOA-VXGBXAGGSA-N |
| XLogP | 1.47 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|