C10H14N5O+ — CID 101172540
2,4-dimethyl-6-(1-methylpyridin-1-ium-4-yl)-1H-1,2,4,5-tetrazin-3-one (PubChem CID 101172540) has the molecular formula C10H14N5O+ and a molecular weight of 220.26 g/mol. Its IUPAC name is 2,4-dimethyl-6-(1-methylpyridin-1-ium-4-yl)-1H-1,2,4,5-tetrazin-3-one.
| Compound Name | 2,4-dimethyl-6-(1-methylpyridin-1-ium-4-yl)-1H-1,2,4,5-tetrazin-3-one |
|---|---|
| PubChem CID | 101172540 |
| Molecular Formula | C10H14N5O+ |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2,4-dimethyl-6-(1-methylpyridin-1-ium-4-yl)-1H-1,2,4,5-tetrazin-3-one |
| SMILES | CN1N=C(c2cc[n+](C)cc2)NN(C)C1=O |
| InChI | InChI=1S/C10H14N5O/c1-13-6-4-8(5-7-13)9-11-14(2)10(16)15(3)12-9/h4-7H,1-3H3,(H,11,12)/q+1 |
| InChIKey | CMYKAOSKYJKSNG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 51.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|