C17H22N2O — CID 101173198
(E)-4-[(3aR,8bS)-3,4-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]-2-methylbut-2-enal (PubChem CID 101173198) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (E)-4-[(3aR,8bS)-3,4-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]-2-methylbut-2-enal.
| Compound Name | (E)-4-[(3aR,8bS)-3,4-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]-2-methylbut-2-enal |
|---|---|
| PubChem CID | 101173198 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (E)-4-[(3aR,8bS)-3,4-dimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-8b-yl]-2-methylbut-2-enal |
| SMILES | C/C(C=O)=C\C[C@@]12CCN(C)[C@@H]1N(C)c1ccccc12 |
| InChI | InChI=1S/C17H22N2O/c1-13(12-20)8-9-17-10-11-18(2)16(17)19(3)15-7-5-4-6-14(15)17/h4-8,12,16H,9-11H2,1-3H3/b13-8+/t16-,17+/m1/s1 |
| InChIKey | TWQLKUVVALYGFN-CYJKWWOWSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|