C24H50B2Si2 — CID 101173274
[(3E,5E,7E)-3,8-bis(diethylboranyl)-7-trimethylsilyldeca-3,5,7-trien-4-yl]-trimethylsilane (PubChem CID 101173274) has the molecular formula C24H50B2Si2 and a molecular weight of 416.46 g/mol. Its IUPAC name is [(3E,5E,7E)-3,8-bis(diethylboranyl)-7-trimethylsilyldeca-3,5,7-trien-4-yl]-trimethylsilane.
| Compound Name | [(3E,5E,7E)-3,8-bis(diethylboranyl)-7-trimethylsilyldeca-3,5,7-trien-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101173274 |
| Molecular Formula | C24H50B2Si2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | [(3E,5E,7E)-3,8-bis(diethylboranyl)-7-trimethylsilyldeca-3,5,7-trien-4-yl]-trimethylsilane |
| SMILES | CCB(CC)/C(CC)=C(/C=C/C(=C(\CC)B(CC)CC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H50B2Si2/c1-13-21(25(15-3)16-4)23(27(7,8)9)19-20-24(28(10,11)12)22(14-2)26(17-5)18-6/h19-20H,13-18H2,1-12H3/b20-19+,23-21-,24-22- |
| InChIKey | SGTWZCAABDIWEF-FZJNOWLPSA-N |
| XLogP | 8.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|