C23H28N2O6 — CID 101173483
(2S)-2-[[5-benzyl-4-[[(1S)-1-carboxy-2-methylpropyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-methylbutanoic acid (PubChem CID 101173483) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S)-2-[[5-benzyl-4-[[(1S)-1-carboxy-2-methylpropyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[5-benzyl-4-[[(1S)-1-carboxy-2-methylpropyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 101173483 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (2S)-2-[[5-benzyl-4-[[(1S)-1-carboxy-2-methylpropyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC1=CC(=O)C(N[C@H](C(=O)O)C(C)C)=C(Cc2ccccc2)C1=O)C(=O)O |
| InChI | InChI=1S/C23H28N2O6/c1-12(2)18(22(28)29)24-16-11-17(26)20(25-19(13(3)4)23(30)31)15(21(16)27)10-14-8-6-5-7-9-14/h5-9,11-13,18-19,24-25H,10H2,1-4H3,(H,28,29)(H,30,31)/t18-,19-/m0/s1 |
| InChIKey | JFBDEPFATHDRJP-OALUTQOASA-N |
| XLogP | 1.92 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|