C24H41N4O3Si+ — CID 101173894
[(2S,8S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methyl 4-(dimethylamino)benzoate (PubChem CID 101173894) has the molecular formula C24H41N4O3Si+ and a molecular weight of 461.70 g/mol. Its IUPAC name is [(2S,8S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methyl 4-(dimethylamino)benzoate.
| Compound Name | [(2S,8S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 101173894 |
| Molecular Formula | C24H41N4O3Si+ |
| Molecular Weight | 461.70 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | [(2S,8S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OC[C@@H]2CC[N+]3=C(N2)N[C@H](CO[Si](C)(C)C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C24H40N4O3Si/c1-24(2,3)32(6,7)31-17-20-13-15-28-14-12-19(25-23(28)26-20)16-30-22(29)18-8-10-21(11-9-18)27(4)5/h8-11,19-20H,12-17H2,1-7H3,(H,25,26)/p+1/t19-,20-/m0/s1 |
| InChIKey | YCJIDRBRZBJVBS-PMACEKPBSA-O |
| XLogP | 3.02 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|