About [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene
[(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene (PubChem CID 101173949) has the molecular formula C16H25O3P
and a molecular weight of 296.35 g/mol. Its IUPAC name is [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene.
Molecular Properties
| Compound Name | [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene |
| PubChem CID | 101173949 |
| Molecular Formula | C16H25O3P |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@@H]1C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C16H25O3P/c1-12(2)18-20(17,19-13(3)4)15-11-16(15,5)14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | PUQFTZHCUOPVIL-CVEARBPZSA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene?
The IUPAC name of [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene (CID 101173949) is [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene.
What is the SMILES notation for [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene?
The canonical SMILES for [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene is CC(C)OP(=O)(OC(C)C)[C@@H]1C[C@@]1(C)c1ccccc1.
What is the InChIKey of [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene?
The InChIKey is PUQFTZHCUOPVIL-CVEARBPZSA-N. The full InChI is InChI=1S/C16H25O3P/c1-12(2)18-20(17,19-13(3)4)15-11-16(15,5)14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3/t15-,16+/m1/s1.
What are the key properties of [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene?
[(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene has a molecular weight of 296.35 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropyl]benzene is sourced from PubChem (CID 101173949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).