C28H44N4O3 — CID 101174054
5-N,5-N,25-N,25-N,9,21-hexamethyl-12,15,18-trioxa-9,21-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene-5,25-diamine (PubChem CID 101174054) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is 5-N,5-N,25-N,25-N,9,21-hexamethyl-12,15,18-trioxa-9,21-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene-5,25-diamine.
| Compound Name | 5-N,5-N,25-N,25-N,9,21-hexamethyl-12,15,18-trioxa-9,21-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene-5,25-diamine |
|---|---|
| PubChem CID | 101174054 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 5-N,5-N,25-N,25-N,9,21-hexamethyl-12,15,18-trioxa-9,21-diazatricyclo[21.4.0.02,7]heptacosa-1(23),2(7),3,5,24,26-hexaene-5,25-diamine |
| SMILES | CN1CCOCCOCCOCCN(C)Cc2cc(N(C)C)ccc2-c2ccc(N(C)C)cc2C1 |
| InChI | InChI=1S/C28H44N4O3/c1-29(2)25-7-9-27-23(19-25)21-31(5)11-13-33-15-17-35-18-16-34-14-12-32(6)22-24-20-26(30(3)4)8-10-28(24)27/h7-10,19-20H,11-18,21-22H2,1-6H3 |
| InChIKey | NPQRNUCTROGARF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |