C31H35NO4Si — CID 101174118
(4S)-3-[(E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101174118) has the molecular formula C31H35NO4Si and a molecular weight of 513.71 g/mol. Its IUPAC name is (4S)-3-[(E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101174118 |
| Molecular Formula | C31H35NO4Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | (4S)-3-[(E,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H](/C=C/C(=O)N1C(=O)OC[C@@H]1c1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H35NO4Si/c1-24(20-21-29(33)32-28(23-35-30(32)34)25-14-8-5-9-15-25)22-36-37(31(2,3)4,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-21,24,28H,22-23H2,1-4H3/b21-20+/t24-,28-/m1/s1 |
| InChIKey | NYUMSCBMHXOZGH-JJPDICORSA-N |
| XLogP | 5.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|