C17H24O3 — CID 101174491
[(5R,6S,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] acetate (PubChem CID 101174491) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(5R,6S,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] acetate.
| Compound Name | [(5R,6S,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] acetate |
|---|---|
| PubChem CID | 101174491 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(5R,6S,11R)-5,7,7,11-tetramethyl-4-oxo-6-tricyclo[6.3.0.01,5]undec-2-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C(C)(C)C2CC[C@@H](C)C23C=CC(=O)[C@@]13C |
| InChI | InChI=1S/C17H24O3/c1-10-6-7-12-15(3,4)14(20-11(2)18)16(5)13(19)8-9-17(10,12)16/h8-10,12,14H,6-7H2,1-5H3/t10-,12?,14+,16+,17?/m1/s1 |
| InChIKey | LKQSYAJIJPIKFF-IWIDPLJRSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |