C26H40N4Si2 — CID 101174794
N'-[(1S,2S)-2-[[phenyl-(trimethylsilylamino)methylidene]amino]cyclohexyl]-N-trimethylsilylbenzenecarboximidamide (PubChem CID 101174794) has the molecular formula C26H40N4Si2 and a molecular weight of 464.81 g/mol. Its IUPAC name is N'-[(1S,2S)-2-[[phenyl-(trimethylsilylamino)methylidene]amino]cyclohexyl]-N-trimethylsilylbenzenecarboximidamide.
| Compound Name | N'-[(1S,2S)-2-[[phenyl-(trimethylsilylamino)methylidene]amino]cyclohexyl]-N-trimethylsilylbenzenecarboximidamide |
|---|---|
| PubChem CID | 101174794 |
| Molecular Formula | C26H40N4Si2 |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N'-[(1S,2S)-2-[[phenyl-(trimethylsilylamino)methylidene]amino]cyclohexyl]-N-trimethylsilylbenzenecarboximidamide |
| SMILES | C[Si](C)(C)N/C(=N\[C@H]1CCCC[C@@H]1/N=C(\N[Si](C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H40N4Si2/c1-31(2,3)29-25(21-15-9-7-10-16-21)27-23-19-13-14-20-24(23)28-26(30-32(4,5)6)22-17-11-8-12-18-22/h7-12,15-18,23-24H,13-14,19-20H2,1-6H3,(H,27,29)(H,28,30)/t23-,24-/m0/s1 |
| InChIKey | HJDCJIGKHDLTQU-ZEQRLZLVSA-N |
| XLogP | 6.04 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|