C18H24O5 — CID 101174828
(2E,4E,6R)-6-[(1S,3S,4R,5S,8S)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoic acid (PubChem CID 101174828) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E,4E,6R)-6-[(1S,3S,4R,5S,8S)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoic acid.
| Compound Name | (2E,4E,6R)-6-[(1S,3S,4R,5S,8S)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 101174828 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2E,4E,6R)-6-[(1S,3S,4R,5S,8S)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]-4-methylhepta-2,4-dienoic acid |
| SMILES | CC(/C=C/C(=O)O)=C\[C@@H](C)[C@@H]1O[C@]2(C)O[C@@H](C=C[C@]23CO3)[C@H]1C |
| InChI | InChI=1S/C18H24O5/c1-11(5-6-15(19)20)9-12(2)16-13(3)14-7-8-18(10-21-18)17(4,22-14)23-16/h5-9,12-14,16H,10H2,1-4H3,(H,19,20)/b6-5+,11-9+/t12-,13-,14+,16+,17+,18+/m1/s1 |
| InChIKey | ZAQBXTSWFAWHMP-QQBMNUJWSA-N |
| XLogP | 2.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|