C62H56BNS2 — CID 101174918
N-[4-[5-[5-bis(2,4,6-trimethylphenyl)boranylthiophen-2-yl]thiophen-2-yl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine (PubChem CID 101174918) has the molecular formula C62H56BNS2 and a molecular weight of 890.08 g/mol. Its IUPAC name is N-[4-[5-[5-bis(2,4,6-trimethylphenyl)boranylthiophen-2-yl]thiophen-2-yl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-[4-[5-[5-bis(2,4,6-trimethylphenyl)boranylthiophen-2-yl]thiophen-2-yl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 101174918 |
| Molecular Formula | C62H56BNS2 |
| Molecular Weight | 890.08 g/mol |
| Exact Mass | 889.39 |
| IUPAC Name | N-[4-[5-[5-bis(2,4,6-trimethylphenyl)boranylthiophen-2-yl]thiophen-2-yl]phenyl]-N-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-amine |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3ccc(-c4ccc(N(c5ccc6c(c5)C(C)(C)c5ccccc5-6)c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)s3)s2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C62H56BNS2/c1-37-31-39(3)59(40(4)32-37)63(60-41(5)33-38(2)34-42(60)6)58-30-29-57(66-58)56-28-27-55(65-56)43-19-21-44(22-20-43)64(45-23-25-49-47-15-11-13-17-51(47)61(7,8)53(49)35-45)46-24-26-50-48-16-12-14-18-52(48)62(9,10)54(50)36-46/h11-36H,1-10H3 |
| InChIKey | OUIBIPHQNOQVIG-UHFFFAOYSA-N |
| XLogP | 15.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.08 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|