About 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide
2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide (PubChem CID 101175012) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide |
| PubChem CID | 101175012 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1CC(C)(C)CC1=O |
| InChI | InChI=1S/C13H23NO2/c1-5-14(6-2)12(16)7-10-8-13(3,4)9-11(10)15/h10H,5-9H2,1-4H3 |
| InChIKey | QBKJGLBSHCRASP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide?
The IUPAC name of 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide (CID 101175012) is 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide.
What is the SMILES notation for 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide?
The canonical SMILES for 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide is CCN(CC)C(=O)CC1CC(C)(C)CC1=O.
What is the InChIKey of 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide?
The InChIKey is QBKJGLBSHCRASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-5-14(6-2)12(16)7-10-8-13(3,4)9-11(10)15/h10H,5-9H2,1-4H3.
What are the key properties of 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide?
2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide has a molecular weight of 225.33 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2-oxocyclopentyl)-N,N-diethylacetamide is sourced from PubChem (CID 101175012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).