C22H32O3 — CID 101175475
3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-4-methoxy-5-methylidenefuran-2-one (PubChem CID 101175475) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-4-methoxy-5-methylidenefuran-2-one.
| Compound Name | 3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-4-methoxy-5-methylidenefuran-2-one |
|---|---|
| PubChem CID | 101175475 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienyl]-4-methoxy-5-methylidenefuran-2-one |
| SMILES | C=C1OC(=O)C(CCCCCC/C=C\C/C=C\C/C=C\CC)=C1OC |
| InChI | InChI=1S/C22H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21(24-3)19(2)25-22(20)23/h5-6,8-9,11-12H,2,4,7,10,13-18H2,1,3H3/b6-5-,9-8-,12-11- |
| InChIKey | UACVRGSPUQDTJA-AGRJPVHOSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|