C38H54O2 — CID 101175552
(4R,7S,8S,11S,12S,18R,21S,22S,25S,26S)-7,21-dimethyl-8,22-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.018,26.021,25]octacosa-1,3(15),5,16,19-pentaene (PubChem CID 101175552) has the molecular formula C38H54O2 and a molecular weight of 542.85 g/mol. Its IUPAC name is (4R,7S,8S,11S,12S,18R,21S,22S,25S,26S)-7,21-dimethyl-8,22-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.018,26.021,25]octacosa-1,3(15),5,16,19-pentaene.
| Compound Name | (4R,7S,8S,11S,12S,18R,21S,22S,25S,26S)-7,21-dimethyl-8,22-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.018,26.021,25]octacosa-1,3(15),5,16,19-pentaene |
|---|---|
| PubChem CID | 101175552 |
| Molecular Formula | C38H54O2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.41 |
| IUPAC Name | (4R,7S,8S,11S,12S,18R,21S,22S,25S,26S)-7,21-dimethyl-8,22-bis[(2-methylpropan-2-yl)oxy]heptacyclo[15.11.0.03,15.04,12.07,11.018,26.021,25]octacosa-1,3(15),5,16,19-pentaene |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2[C@@H]3CCc4cc5c(cc4[C@@H]3C=C[C@]12C)CC[C@@H]1[C@H]5C=C[C@]2(C)[C@@H](OC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C38H54O2/c1-35(2,3)39-33-15-13-31-27-11-9-23-22-30-24(21-29(23)25(27)17-19-37(31,33)7)10-12-28-26(30)18-20-38(8)32(28)14-16-34(38)40-36(4,5)6/h17-22,25-28,31-34H,9-16H2,1-8H3/t25-,26-,27-,28-,31+,32+,33+,34+,37+,38+/m1/s1 |
| InChIKey | STTYMDRAGMJKBD-BOWIWJBSSA-N |
| XLogP | 9.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|