About (4-tert-butylcyclohexyl) carbonofluoridate
(4-tert-butylcyclohexyl) carbonofluoridate (PubChem CID 101175862) has the molecular formula C11H19FO2
and a molecular weight of 202.27 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) carbonofluoridate.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexyl) carbonofluoridate |
| PubChem CID | 101175862 |
| Molecular Formula | C11H19FO2 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (4-tert-butylcyclohexyl) carbonofluoridate |
| SMILES | CC(C)(C)C1CCC(OC(=O)F)CC1 |
| InChI | InChI=1S/C11H19FO2/c1-11(2,3)8-4-6-9(7-5-8)14-10(12)13/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZRWKTIKKTSIMEO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylcyclohexyl) carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexyl) carbonofluoridate?
The IUPAC name of (4-tert-butylcyclohexyl) carbonofluoridate (CID 101175862) is (4-tert-butylcyclohexyl) carbonofluoridate.
What is the SMILES notation for (4-tert-butylcyclohexyl) carbonofluoridate?
The canonical SMILES for (4-tert-butylcyclohexyl) carbonofluoridate is CC(C)(C)C1CCC(OC(=O)F)CC1.
What is the InChIKey of (4-tert-butylcyclohexyl) carbonofluoridate?
The InChIKey is ZRWKTIKKTSIMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO2/c1-11(2,3)8-4-6-9(7-5-8)14-10(12)13/h8-9H,4-7H2,1-3H3.
What are the key properties of (4-tert-butylcyclohexyl) carbonofluoridate?
(4-tert-butylcyclohexyl) carbonofluoridate has a molecular weight of 202.27 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexyl) carbonofluoridate is sourced from PubChem (CID 101175862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).