About (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one
(5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 101175875) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one.
Molecular Properties
| Compound Name | (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| PubChem CID | 101175875 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | COC1=C[C@@]2(C=CC1=O)CCC(C(C)C)O2 |
| InChI | InChI=1S/C13H18O3/c1-9(2)11-5-7-13(16-11)6-4-10(14)12(8-13)15-3/h4,6,8-9,11H,5,7H2,1-3H3/t11?,13-/m1/s1 |
| InChIKey | IKNANUFEMVLMRH-GLGOKHISSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The IUPAC name of (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one (CID 101175875) is (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one.
What is the SMILES notation for (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The canonical SMILES for (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one is COC1=C[C@@]2(C=CC1=O)CCC(C(C)C)O2.
What is the InChIKey of (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
The InChIKey is IKNANUFEMVLMRH-GLGOKHISSA-N. The full InChI is InChI=1S/C13H18O3/c1-9(2)11-5-7-13(16-11)6-4-10(14)12(8-13)15-3/h4,6,8-9,11H,5,7H2,1-3H3/t11?,13-/m1/s1.
What are the key properties of (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one?
(5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one has a molecular weight of 222.28 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-methoxy-2-propan-2-yl-1-oxaspiro[4.5]deca-6,9-dien-8-one is sourced from PubChem (CID 101175875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).