C20H33NO3 — CID 101176545
[(1S)-1-(2-methoxyphenyl)hexyl] N,N-di(propan-2-yl)carbamate (PubChem CID 101176545) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is [(1S)-1-(2-methoxyphenyl)hexyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(1S)-1-(2-methoxyphenyl)hexyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 101176545 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | [(1S)-1-(2-methoxyphenyl)hexyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CCCCC[C@H](OC(=O)N(C(C)C)C(C)C)c1ccccc1OC |
| InChI | InChI=1S/C20H33NO3/c1-7-8-9-14-19(17-12-10-11-13-18(17)23-6)24-20(22)21(15(2)3)16(4)5/h10-13,15-16,19H,7-9,14H2,1-6H3/t19-/m0/s1 |
| InChIKey | JBBFXTJDIAPSOS-IBGZPJMESA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|