C15H4F22 — CID 101176818
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopenta-1,3-diene (PubChem CID 101176818) has the molecular formula C15H4F22 and a molecular weight of 602.15 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopenta-1,3-diene.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 101176818 |
| Molecular Formula | C15H4F22 |
| Molecular Weight | 602.15 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1=CC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C15H4F22/c16-6(17,8(20,21)10(24,25)11(26,27)13(30,31)15(35,36)37)4-1-2-5(3-4)7(18,19)9(22,23)12(28,29)14(32,33)34/h1-4H |
| InChIKey | SFKNRAUUXVBTEJ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.15 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|