C27H22F6N2S2+2 — CID 101177170
3-[(1R,2R)-8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-3-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium (PubChem CID 101177170) has the molecular formula C27H22F6N2S2+2 and a molecular weight of 552.61 g/mol. Its IUPAC name is 3-[(1R,2R)-8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-3-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 3-[(1R,2R)-8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-3-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 101177170 |
| Molecular Formula | C27H22F6N2S2+2 |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 3-[(1R,2R)-8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-3-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1cccc(C2=CC3=C4C(=C5C=C(c6ccc[n+](C)c6)S[C@@]5(C)[C@]3(C)S2)C(F)(F)C(F)(F)C4(F)F)c1 |
| InChI | InChI=1S/C27H22F6N2S2/c1-23-17(11-19(36-23)15-7-5-9-34(3)13-15)21-22(26(30,31)27(32,33)25(21,28)29)18-12-20(37-24(18,23)2)16-8-6-10-35(4)14-16/h5-14H,1-4H3/q+2/t23-,24-/m1/s1 |
| InChIKey | OBDSMQWDWHJSNZ-DNQXCXABSA-N |
| XLogP | 6.25 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|