C20H34O — CID 101177196
(1R,4S,5R)-4-[(3R)-3,7-dimethyloct-6-enyl]-4,6,6-trimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 101177196) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (1R,4S,5R)-4-[(3R)-3,7-dimethyloct-6-enyl]-4,6,6-trimethylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (1R,4S,5R)-4-[(3R)-3,7-dimethyloct-6-enyl]-4,6,6-trimethylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 101177196 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (1R,4S,5R)-4-[(3R)-3,7-dimethyloct-6-enyl]-4,6,6-trimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CC(C)=CCC[C@@H](C)CC[C@@]1(C)CC(=O)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C20H34O/c1-14(2)8-7-9-15(3)10-11-20(6)13-17(21)16-12-18(20)19(16,4)5/h8,15-16,18H,7,9-13H2,1-6H3/t15-,16+,18+,20+/m1/s1 |
| InChIKey | KCXXXEDYEQRMJU-JMVFIXPQSA-N |
| XLogP | 5.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|