C16H20F3NO2 — CID 101177234
tert-butyl N-[(2S)-1-phenyl-3-(trifluoromethyl)but-3-en-2-yl]carbamate (PubChem CID 101177234) has the molecular formula C16H20F3NO2 and a molecular weight of 315.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-phenyl-3-(trifluoromethyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-phenyl-3-(trifluoromethyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 101177234 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-phenyl-3-(trifluoromethyl)but-3-en-2-yl]carbamate |
| SMILES | C=C([C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO2/c1-11(16(17,18)19)13(10-12-8-6-5-7-9-12)20-14(21)22-15(2,3)4/h5-9,13H,1,10H2,2-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | GCRPAYGVMOCZDM-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|