C12H16 — CID 101177780
1-[(1E,3E)-hexa-1,3,5-trienyl]-1-prop-2-enylcyclopropane (PubChem CID 101177780) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-[(1E,3E)-hexa-1,3,5-trienyl]-1-prop-2-enylcyclopropane.
| Compound Name | 1-[(1E,3E)-hexa-1,3,5-trienyl]-1-prop-2-enylcyclopropane |
|---|---|
| PubChem CID | 101177780 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-[(1E,3E)-hexa-1,3,5-trienyl]-1-prop-2-enylcyclopropane |
| SMILES | C=C/C=C/C=C/C1(CC=C)CC1 |
| InChI | InChI=1S/C12H16/c1-3-5-6-7-9-12(8-4-2)10-11-12/h3-7,9H,1-2,8,10-11H2/b6-5+,9-7+ |
| InChIKey | PVJURJDHNVZJLB-SBIWHPGTSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|