C14H24O3Si — CID 101178884
[(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxyprop-1-ynyl]-trimethylsilane (PubChem CID 101178884) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is [(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxyprop-1-ynyl]-trimethylsilane.
| Compound Name | [(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxyprop-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 101178884 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxyprop-1-ynyl]-trimethylsilane |
| SMILES | C=CCO[C@H](C#C[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H24O3Si/c1-7-9-15-12(8-10-18(4,5)6)13-11-16-14(2,3)17-13/h7,12-13H,1,9,11H2,2-6H3/t12-,13-/m1/s1 |
| InChIKey | MJNADMFGNIUIKO-CHWSQXEVSA-N |
| XLogP | 2.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|