C22H20ClN5O3S2 — CID 10117905
6-chloro-N-[1-[(1,6-diaminoisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide (PubChem CID 10117905) has the molecular formula C22H20ClN5O3S2 and a molecular weight of 502.02 g/mol. Its IUPAC name is 6-chloro-N-[1-[(1,6-diaminoisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide.
| Compound Name | 6-chloro-N-[1-[(1,6-diaminoisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10117905 |
| Molecular Formula | C22H20ClN5O3S2 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 6-chloro-N-[1-[(1,6-diaminoisoquinolin-7-yl)methyl]-2-oxopyrrolidin-3-yl]-1-benzothiophene-2-sulfonamide |
| SMILES | Nc1cc2ccnc(N)c2cc1CN1CCC(NS(=O)(=O)c2cc3ccc(Cl)cc3s2)C1=O |
| InChI | InChI=1S/C22H20ClN5O3S2/c23-15-2-1-13-9-20(32-19(13)10-15)33(30,31)27-18-4-6-28(22(18)29)11-14-7-16-12(8-17(14)24)3-5-26-21(16)25/h1-3,5,7-10,18,27H,4,6,11,24H2,(H2,25,26) |
| InChIKey | WRLLLNUDQYFZMH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|