C13H19ClO3 — CID 101179107
(1R,3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 101179107) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is (1R,3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | (1R,3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 101179107 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (1R,3aR,6aS)-1-chloro-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | CC1(C)COC2(C[C@H]3CC(=O)[C@H](Cl)[C@H]3C2)OC1 |
| InChI | InChI=1S/C13H19ClO3/c1-12(2)6-16-13(17-7-12)4-8-3-10(15)11(14)9(8)5-13/h8-9,11H,3-7H2,1-2H3/t8-,9+,11-/m1/s1 |
| InChIKey | ILLYFUOVWHBQHJ-WCABBAIRSA-N |
| XLogP | 2.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|