C17H17F3N2O2S — CID 101179215
(3aR,4R,8aR,8bR)-4-methylsulfanyl-2-phenyl-4-(trifluoromethyl)-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 101179215) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is (3aR,4R,8aR,8bR)-4-methylsulfanyl-2-phenyl-4-(trifluoromethyl)-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4R,8aR,8bR)-4-methylsulfanyl-2-phenyl-4-(trifluoromethyl)-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 101179215 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (3aR,4R,8aR,8bR)-4-methylsulfanyl-2-phenyl-4-(trifluoromethyl)-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | CS[C@@]1(C(F)(F)F)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]2CCCN21 |
| InChI | InChI=1S/C17H17F3N2O2S/c1-25-16(17(18,19)20)13-12(11-8-5-9-21(11)16)14(23)22(15(13)24)10-6-3-2-4-7-10/h2-4,6-7,11-13H,5,8-9H2,1H3/t11-,12+,13-,16-/m1/s1 |
| InChIKey | NBHPVXHAYAZVFA-OQMKEHIESA-N |
| XLogP | 2.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|