C15H22ClN3 — CID 101179489
3-(4-chlorophenyl)-1-N,1-N,1-N',1-N',1-N",1-N"-hexamethylprop-2-yne-1,1,1-triamine (PubChem CID 101179489) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-N,1-N,1-N',1-N',1-N",1-N"-hexamethylprop-2-yne-1,1,1-triamine.
| Compound Name | 3-(4-chlorophenyl)-1-N,1-N,1-N',1-N',1-N",1-N"-hexamethylprop-2-yne-1,1,1-triamine |
|---|---|
| PubChem CID | 101179489 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-(4-chlorophenyl)-1-N,1-N,1-N',1-N',1-N",1-N"-hexamethylprop-2-yne-1,1,1-triamine |
| SMILES | CN(C)C(C#Cc1ccc(Cl)cc1)(N(C)C)N(C)C |
| InChI | InChI=1S/C15H22ClN3/c1-17(2)15(18(3)4,19(5)6)12-11-13-7-9-14(16)10-8-13/h7-10H,1-6H3 |
| InChIKey | IZCQVCIYNFDWNN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|