C12H25N3O — CID 101179495
1-(3,4-dihydro-2H-pyran-6-yl)-N,N,N',N',N",N"-hexamethylmethanetriamine (PubChem CID 101179495) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-N,N,N',N',N",N"-hexamethylmethanetriamine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N,N,N',N',N",N"-hexamethylmethanetriamine |
|---|---|
| PubChem CID | 101179495 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N,N,N',N',N",N"-hexamethylmethanetriamine |
| SMILES | CN(C)C(C1=CCCCO1)(N(C)C)N(C)C |
| InChI | InChI=1S/C12H25N3O/c1-13(2)12(14(3)4,15(5)6)11-9-7-8-10-16-11/h9H,7-8,10H2,1-6H3 |
| InChIKey | CXODUXZHRFORMH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|