C21H31NO2 — CID 101180429
2-[[(3R,4S)-2,2-dimethyl-1-oxaspiro[2.5]octan-4-yl]oxy]-1,1,3,3-tetramethylisoindole (PubChem CID 101180429) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-[[(3R,4S)-2,2-dimethyl-1-oxaspiro[2.5]octan-4-yl]oxy]-1,1,3,3-tetramethylisoindole.
| Compound Name | 2-[[(3R,4S)-2,2-dimethyl-1-oxaspiro[2.5]octan-4-yl]oxy]-1,1,3,3-tetramethylisoindole |
|---|---|
| PubChem CID | 101180429 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-[[(3R,4S)-2,2-dimethyl-1-oxaspiro[2.5]octan-4-yl]oxy]-1,1,3,3-tetramethylisoindole |
| SMILES | CC1(C)c2ccccc2C(C)(C)N1O[C@H]1CCCC[C@@]12OC2(C)C |
| InChI | InChI=1S/C21H31NO2/c1-18(2)15-11-7-8-12-16(15)19(3,4)22(18)23-17-13-9-10-14-21(17)20(5,6)24-21/h7-8,11-12,17H,9-10,13-14H2,1-6H3/t17-,21+/m0/s1 |
| InChIKey | ONPPTZFQMOXNBB-LAUBAEHRSA-N |
| XLogP | 4.89 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|