C31H36O6 — CID 10118056
7-[3-(4-phenoxy-2-propylphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10118056) has the molecular formula C31H36O6 and a molecular weight of 504.62 g/mol. Its IUPAC name is 7-[3-(4-phenoxy-2-propylphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 7-[3-(4-phenoxy-2-propylphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10118056 |
| Molecular Formula | C31H36O6 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 7-[3-(4-phenoxy-2-propylphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CCCc1cc(Oc2ccccc2)ccc1OCCCOc1ccc2c(c1)OC(CCC)(C(=O)O)CC2 |
| InChI | InChI=1S/C31H36O6/c1-3-9-24-21-27(36-25-10-6-5-7-11-25)14-15-28(24)35-20-8-19-34-26-13-12-23-16-18-31(17-4-2,30(32)33)37-29(23)22-26/h5-7,10-15,21-22H,3-4,8-9,16-20H2,1-2H3,(H,32,33) |
| InChIKey | JHPUSZOXXQWTST-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|