About N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine
N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine (PubChem CID 101180694) has the molecular formula C16H25Cl3N2
and a molecular weight of 351.75 g/mol. Its IUPAC name is N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine |
| PubChem CID | 101180694 |
| Molecular Formula | C16H25Cl3N2 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine |
| SMILES | CCN(CC)Cc1c(Cl)cc(Cl)c(Cl)c1CN(CC)CC |
| InChI | InChI=1S/C16H25Cl3N2/c1-5-20(6-2)10-12-13(11-21(7-3)8-4)16(19)15(18)9-14(12)17/h9H,5-8,10-11H2,1-4H3 |
| InChIKey | KSMUCDKJBMBLEU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine?
The IUPAC name of N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine (CID 101180694) is N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine.
What is the SMILES notation for N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine?
The canonical SMILES for N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine is CCN(CC)Cc1c(Cl)cc(Cl)c(Cl)c1CN(CC)CC.
What is the InChIKey of N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine?
The InChIKey is KSMUCDKJBMBLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl3N2/c1-5-20(6-2)10-12-13(11-21(7-3)8-4)16(19)15(18)9-14(12)17/h9H,5-8,10-11H2,1-4H3.
What are the key properties of N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine?
N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine has a molecular weight of 351.75 g/mol, XLogP of 5.33, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[[3,4,6-trichloro-2-(diethylaminomethyl)phenyl]methyl]ethanamine is sourced from PubChem (CID 101180694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).