C23H20N2O7 — CID 101181542
[(6R,7R)-6-acetyl-7-methyl-2-oxo-3-phenyl-5,7-dihydro-4H-1,3-benzoxazol-6-yl] 4-nitrobenzoate (PubChem CID 101181542) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is [(6R,7R)-6-acetyl-7-methyl-2-oxo-3-phenyl-5,7-dihydro-4H-1,3-benzoxazol-6-yl] 4-nitrobenzoate.
| Compound Name | [(6R,7R)-6-acetyl-7-methyl-2-oxo-3-phenyl-5,7-dihydro-4H-1,3-benzoxazol-6-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 101181542 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [(6R,7R)-6-acetyl-7-methyl-2-oxo-3-phenyl-5,7-dihydro-4H-1,3-benzoxazol-6-yl] 4-nitrobenzoate |
| SMILES | CC(=O)[C@@]1(OC(=O)c2ccc([N+](=O)[O-])cc2)CCc2c(oc(=O)n2-c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H20N2O7/c1-14-20-19(24(22(28)31-20)17-6-4-3-5-7-17)12-13-23(14,15(2)26)32-21(27)16-8-10-18(11-9-16)25(29)30/h3-11,14H,12-13H2,1-2H3/t14-,23-/m1/s1 |
| InChIKey | GZKUWNVFTVWRTH-QKFKETGDSA-N |
| XLogP | 3.57 |
| TPSA | 121.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|