C18H27NO2Si — CID 101181627
(4S)-4-phenyl-3-[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]-1,3-oxazolidin-2-one (PubChem CID 101181627) has the molecular formula C18H27NO2Si and a molecular weight of 317.50 g/mol. Its IUPAC name is (4S)-4-phenyl-3-[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-phenyl-3-[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101181627 |
| Molecular Formula | C18H27NO2Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (4S)-4-phenyl-3-[(3R,4R)-4-trimethylsilylhex-5-en-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]([C@@H](CC)N1C(=O)OC[C@@H]1c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H27NO2Si/c1-6-15(17(7-2)22(3,4)5)19-16(13-21-18(19)20)14-11-9-8-10-12-14/h7-12,15-17H,2,6,13H2,1,3-5H3/t15-,16-,17-/m1/s1 |
| InChIKey | ZDUXZGYOFBAMFF-BRWVUGGUSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|