C20H25NO3 — CID 101181673
methyl (E)-3-[(2S,3R,6S)-1-but-3-enyl-3-methyl-4-oxo-6-phenylpiperidin-2-yl]prop-2-enoate (PubChem CID 101181673) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3R,6S)-1-but-3-enyl-3-methyl-4-oxo-6-phenylpiperidin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3R,6S)-1-but-3-enyl-3-methyl-4-oxo-6-phenylpiperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101181673 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (E)-3-[(2S,3R,6S)-1-but-3-enyl-3-methyl-4-oxo-6-phenylpiperidin-2-yl]prop-2-enoate |
| SMILES | C=CCCN1[C@H](c2ccccc2)CC(=O)[C@H](C)[C@@H]1/C=C/C(=O)OC |
| InChI | InChI=1S/C20H25NO3/c1-4-5-13-21-17(11-12-20(23)24-3)15(2)19(22)14-18(21)16-9-7-6-8-10-16/h4,6-12,15,17-18H,1,5,13-14H2,2-3H3/b12-11+/t15-,17+,18+/m1/s1 |
| InChIKey | AZVLEDQTYGVVNM-FUVLYEJUSA-N |
| XLogP | 3.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|