C18H4 — CID 101181692
octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadeca-1(10),2(9),3(8),4(7),5,11(18),12(17),13(16),14-nonaene (PubChem CID 101181692) has the molecular formula C18H4 and a molecular weight of 220.23 g/mol. Its IUPAC name is octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadeca-1(10),2(9),3(8),4(7),5,11(18),12(17),13(16),14-nonaene.
| Compound Name | octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadeca-1(10),2(9),3(8),4(7),5,11(18),12(17),13(16),14-nonaene |
|---|---|
| PubChem CID | 101181692 |
| Molecular Formula | C18H4 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | octacyclo[8.8.0.02,9.03,8.04,7.011,18.012,17.013,16]octadeca-1(10),2(9),3(8),4(7),5,11(18),12(17),13(16),14-nonaene |
| SMILES | c1cc2c1c1c2c2c1c1c3c4c5ccc5c4c3c21 |
| InChI | InChI=1S/C18H4/c1-2-6-5(1)9-10(6)14-13(9)17-15-11-7-3-4-8(7)12(11)16(15)18(14)17/h1-4H |
| InChIKey | AFYVVAAYGXUESK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|