C18H32O3Si — CID 101181783
methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-9,9,9-trideuterio-4,8-dimethylnon-7-en-2-ynoate (PubChem CID 101181783) has the molecular formula C18H32O3Si and a molecular weight of 327.56 g/mol. Its IUPAC name is methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-9,9,9-trideuterio-4,8-dimethylnon-7-en-2-ynoate.
| Compound Name | methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-9,9,9-trideuterio-4,8-dimethylnon-7-en-2-ynoate |
|---|---|
| PubChem CID | 101181783 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | methyl (E)-4-[tert-butyl(dimethyl)silyl]oxy-9,9,9-trideuterio-4,8-dimethylnon-7-en-2-ynoate |
| SMILES | [2H]C([2H])([2H])/C(C)=C/CCC(C)(C#CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-15(2)11-10-13-18(6,14-12-16(19)20-7)21-22(8,9)17(3,4)5/h11H,10,13H2,1-9H3/i1D3/b15-11- |
| InChIKey | ISEGVCIBTONQRI-BORNIKESSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|