C19H19ClO8 — CID 101181943
[(1S,2S,5R,7S,10R,12R,13S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10,12-dihydroxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-yl] 2-chloroacetate (PubChem CID 101181943) has the molecular formula C19H19ClO8 and a molecular weight of 410.81 g/mol. Its IUPAC name is [(1S,2S,5R,7S,10R,12R,13S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10,12-dihydroxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-yl] 2-chloroacetate.
| Compound Name | [(1S,2S,5R,7S,10R,12R,13S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10,12-dihydroxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 101181943 |
| Molecular Formula | C19H19ClO8 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [(1S,2S,5R,7S,10R,12R,13S)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-10,12-dihydroxy-6,14-dioxatetracyclo[8.4.0.01,13.05,7]tetradeca-3,8-diyn-2-yl] 2-chloroacetate |
| SMILES | CC1(C)OC[C@H]([C@]23C#C[C@]4(O)C[C@@H](O)[C@@H]5O[C@@]54[C@@H](OC(=O)CCl)C#C[C@H]2O3)O1 |
| InChI | InChI=1S/C19H19ClO8/c1-16(2)24-9-13(26-16)18-6-5-17(23)7-10(21)15-19(17,28-15)12(25-14(22)8-20)4-3-11(18)27-18/h10-13,15,21,23H,7-9H2,1-2H3/t10-,11-,12+,13-,15+,17+,18+,19+/m1/s1 |
| InChIKey | XPLXPLGWBCLJPJ-AFMJBFEVSA-N |
| XLogP | -0.92 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|