C15H20O3Si — CID 101181987
1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9-diene-3,6-dione (PubChem CID 101181987) has the molecular formula C15H20O3Si and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9-diene-3,6-dione.
| Compound Name | 1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 101181987 |
| Molecular Formula | C15H20O3Si |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-trimethylsilyloxytricyclo[6.2.2.02,7]dodeca-4,9-diene-3,6-dione |
| SMILES | C[Si](C)(C)OC12C=CC(CC1)C1C(=O)C=CC(=O)C12 |
| InChI | InChI=1S/C15H20O3Si/c1-19(2,3)18-15-8-6-10(7-9-15)13-11(16)4-5-12(17)14(13)15/h4-6,8,10,13-14H,7,9H2,1-3H3 |
| InChIKey | WWHHVUREKGCSEC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|