C25H36N2O9 — CID 10118252
methyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate (PubChem CID 10118252) has the molecular formula C25H36N2O9 and a molecular weight of 508.57 g/mol. Its IUPAC name is methyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate.
| Compound Name | methyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 10118252 |
| Molecular Formula | C25H36N2O9 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | methyl [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxyoxan-2-yl]methyl carbonate |
| SMILES | COC(=O)OC[C@H]1O[C@@H](Oc2nn(C(C)C)c(C)c2Cc2ccc(OC(C)C)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H36N2O9/c1-13(2)27-15(5)18(11-16-7-9-17(10-8-16)34-14(3)4)23(26-27)36-24-22(30)21(29)20(28)19(35-24)12-33-25(31)32-6/h7-10,13-14,19-22,24,28-30H,11-12H2,1-6H3/t19-,20-,21+,22-,24+/m1/s1 |
| InChIKey | LABHIKDFEMCEAC-AREVGRJGSA-N |
| XLogP | 2.12 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |