About 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one
3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 101182543) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one |
| PubChem CID | 101182543 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC/C=C/N1CCOC1=O |
| InChI | InChI=1S/C10H17NO2/c1-2-3-4-5-6-7-11-8-9-13-10(11)12/h6-7H,2-5,8-9H2,1H3/b7-6+ |
| InChIKey | QIKYSTLNHKPVEC-VOTSOKGWSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one (CID 101182543) is 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one is CCCCC/C=C/N1CCOC1=O.
What is the InChIKey of 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one?
The InChIKey is QIKYSTLNHKPVEC-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-3-4-5-6-7-11-8-9-13-10(11)12/h6-7H,2-5,8-9H2,1H3/b7-6+.
What are the key properties of 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one?
3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one has a molecular weight of 183.25 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-hept-1-enyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 101182543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).