C16H14O — CID 101182639
(E)-(1-phenyl-1,3-dihydroinden-2-ylidene)methanol (PubChem CID 101182639) has the molecular formula C16H14O and a molecular weight of 222.29 g/mol. Its IUPAC name is (E)-(1-phenyl-1,3-dihydroinden-2-ylidene)methanol.
| Compound Name | (E)-(1-phenyl-1,3-dihydroinden-2-ylidene)methanol |
|---|---|
| PubChem CID | 101182639 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (E)-(1-phenyl-1,3-dihydroinden-2-ylidene)methanol |
| SMILES | O/C=C1\Cc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C16H14O/c17-11-14-10-13-8-4-5-9-15(13)16(14)12-6-2-1-3-7-12/h1-9,11,16-17H,10H2/b14-11+ |
| InChIKey | GBYVFHVYYYNTOS-SDNWHVSQSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|